Compound Q&A

What are the physical and chemical properties of tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

Answer

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate
tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is a white crystalline solid with a molecular weight of approximately 185.26 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is known for its amine functionality and its ability to react with carbonyl compounds through nucleophilic substitution. It has a pKa of around 8.5, indicating basic properties.

About

English Name tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)NC1CCC(C1)N
InChIKey PGBVMVTUWHCOHX-YUMQZZPRSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8) typically synthesized?

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is typically synthesized via a multistep process, ...

Compound Q&A

What industries use tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

Proper handling of tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate requires the use of personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...