Compound Q&A

What industries use 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

Answer

1-Bromo-3-methyl-5-nitrobenzene
1-Bromo-3-methyl-5-nitrobenzene is used in the pharmaceutical industry for the synthesis of various drugs and intermediates. It is also utilized in the polymer industry for the development of advanced materials. Additionally, this compound finds applications in the production of sensors and semiconductors due to its electronic properties.

About

CAS No 52488-28-5
English Name 1-Bromo-3-methyl-5-nitrobenzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=CC(=CC(=C1)Br)[N+](=O)[O-]
InChIKey MWFDNXJPZUOTJB-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

1-Bromo-3-methyl-5-nitrobenzene is a crystalline solid with a molecular weight of approximately 222....

Compound Q&A

How is 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5) typically synthesized?

1-Bromo-3-methyl-5-nitrobenzene is commonly synthesized by bromination of 3-methyl-5-nitrobenzoic ac...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

When handling 1-Bromo-3-methyl-5-nitrobenzene, it is essential to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...