Compound Q&A

How is 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5) typically synthesized?

Answer

1-Bromo-3-methyl-5-nitrobenzene
1-Bromo-3-methyl-5-nitrobenzene is commonly synthesized by bromination of 3-methyl-5-nitrobenzoic acid followed by bromination. This process involves using bromine in the presence of a Lewis acid catalyst like aluminum bromide to introduce the bromine substituent. The reaction is typically carried out in an organic solvent such as dichloromethane at a temperature around 0°C to improve yield and selectivity.

About

CAS No 52488-28-5
English Name 1-Bromo-3-methyl-5-nitrobenzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=CC(=CC(=C1)Br)[N+](=O)[O-]
InChIKey MWFDNXJPZUOTJB-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

1-Bromo-3-methyl-5-nitrobenzene is a crystalline solid with a molecular weight of approximately 222....

Compound Q&A

What industries use 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

1-Bromo-3-methyl-5-nitrobenzene is used in the pharmaceutical industry for the synthesis of various ...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-methyl-5-nitrobenzene (CAS: 52488-28-5)?

When handling 1-Bromo-3-methyl-5-nitrobenzene, it is essential to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...