Compound Q&A

How is 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6) typically synthesized?

Answer

4-Amino-2-nitrobenzoic acid
4-Amino-2-nitrobenzoic acid can be synthesized via the nitration of 2-amino benzoic acid. This process involves the use of concentrated sulfuric acid as a catalyst and nitric acid as the nitration agent. The reaction is carried out under controlled conditions to achieve high selectivity and yield.

About

CAS No 610-36-6
English Name 4-Amino-2-nitrobenzoic acid
Molecular Formula C7H6N2O4
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1N)[N+](=O)[O-])C(=O)O
InChIKey SAJYSJVBNGUWJK-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

4-Amino-2-nitrobenzoic acid is a crystalline compound with a molecular weight of approximately 200.0...

Compound Q&A

What industries use 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

4-Amino-2-nitrobenzoic acid is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...