Compound Q&A

What are the physical and chemical properties of 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

Answer

4-Amino-2-nitrobenzoic acid
4-Amino-2-nitrobenzoic acid is a crystalline compound with a molecular weight of approximately 200.08 g/mol. It has a solubility of about 0.16 g/100 mL in water. This compound is relatively stable, but it can react with bases and reducing agents. It is used in organic synthesis due to its reactivity and functional groups.

About

CAS No 610-36-6
English Name 4-Amino-2-nitrobenzoic acid
Molecular Formula C7H6N2O4
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1N)[N+](=O)[O-])C(=O)O
InChIKey SAJYSJVBNGUWJK-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6) typically synthesized?

4-Amino-2-nitrobenzoic acid can be synthesized via the nitration of 2-amino benzoic acid. This proce...

Compound Q&A

What industries use 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

4-Amino-2-nitrobenzoic acid is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-nitrobenzoic acid (CAS: 610-36-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...