Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in drug discovery and development, particularly in the synthesis of peptides and peptidomimetics. Additionally, it finds applications in the production of polymers and functional materials for sensors and semiconductors.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline
Molecular Formula C20H21NO4
Molecular Weight 339.39 g/mol
SMILES CC[C@@](C(=O)O)(NC(=O)OCC1c2ccccc2c2c1cccc2)C
InChIKey DZSLHAJXIQCMLR-FQEVSTJZSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is a white crystalline solid with a molecular weigh...

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9) typically synthesized?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is synthesized through a multi-step process involvi...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline, it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...