Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is a white crystalline solid with a molecular weight of approximately 357.38 g/mol. It is slightly soluble in water and readily soluble in organic solvents such as methanol and dimethylformamide. The compound is known for its reactivity in forming esters and peptides. It is typically used as a building block in organic synthesis and drug development.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline
Molecular Formula C20H21NO4
Molecular Weight 339.39 g/mol
SMILES CC[C@@](C(=O)O)(NC(=O)OCC1c2ccccc2c2c1cccc2)C
InChIKey DZSLHAJXIQCMLR-FQEVSTJZSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9) typically synthesized?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is synthesized through a multi-step process involvi...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline is primarily used in the pharmaceutical and chemica...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline (CAS: 857478-30-9)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isovaline, it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...