Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5) typically synthesized?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate
2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is typically synthesized by the reaction of 4-methylbenzenesulfonyl chloride with 2-hydroxy-N,N,N-trimethylethanamine in the presence of a base, such as triethylamine, followed by workup and purification techniques like column chromatography and recrystallization.

About

CAS No 55357-38-5
English Name 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate
Molecular Formula C12H21NO4S
Molecular Weight 275.37 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)CCO
InChIKey DVGVMQVOCJNXNJ-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is a crystalline solid with a molecul...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is utilized in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

When handling 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate, it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...