Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate
2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is a crystalline solid with a molecular weight of approximately 264.26 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound exhibits good stability in neutral and slightly basic environments but is reactive towards strong acids. It does not show significant volatility or flammability.

About

CAS No 55357-38-5
English Name 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate
Molecular Formula C12H21NO4S
Molecular Weight 275.37 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)CCO
InChIKey DVGVMQVOCJNXNJ-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5) typically synthesized?

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is typically synthesized by the react...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate is utilized in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate (CAS: 55357-38-5)?

When handling 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate, it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...