Compound Q&A

What industries use (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

Answer

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid
(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid finds application in the pharmaceutical industry, where it acts as a key intermediate in the synthesis of various drug molecules. It is also utilized in the polymer industry for functionalization purposes and in the sensor industry for detecting specific analytes. Additionally, it plays a role in semiconductor manufacturing as a precursor in material synthesis.

About

CAS No 20445-31-2
English Name (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid
Molecular Formula C10H9F3O3
Molecular Weight 234.17 g/mol
SMILES COC(C1=CC=CC=C1)(C(=O)O)C(F)(F)F
InChIKey JJYKJUXBWFATTE-SECBINFHSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid is a white crystalline solid with a molecular ...

Compound Q&A

How is (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2) typically synthesized?

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid is synthesized through a multi-step process in...

Compound Q&A

What precautions should be taken when handling (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

When handling (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...