Compound Q&A

How is (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2) typically synthesized?

Answer

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid
(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid is synthesized through a multi-step process involving the protection of the phenolic hydroxyl group, fluoroalkylation, and deprotection. Commonly, the synthesis involves using fluoroform, phenol, and appropriate protecting agents such as tert-butyldimethylsilyl chloride. The reaction typically yields a mixture of stereoisomers, and enantioselective methods can be employed for higher selectivity.

About

CAS No 20445-31-2
English Name (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid
Molecular Formula C10H9F3O3
Molecular Weight 234.17 g/mol
SMILES COC(C1=CC=CC=C1)(C(=O)O)C(F)(F)F
InChIKey JJYKJUXBWFATTE-SECBINFHSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid is a white crystalline solid with a molecular ...

Compound Q&A

What industries use (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

(2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid finds application in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid (CAS: 20445-31-2)?

When handling (2R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...