Compound Q&A

What are the physical and chemical properties of Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate (CAS: 122188-02-7)?

Answer

Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate
Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate is a crystalline compound with a molecular weight of approximately 332.42 g/mol. It has a limited water solubility and is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, showing some susceptibility to hydrolysis and oxidation. It exhibits a characteristic UV absorbance peak at 280 nm, which can be used for analytical purposes.

About

English Name Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate
Molecular Formula C18H23NO3
Molecular Weight 301.39 g/mol
SMILES CCC1=C2C(=CC=C1)C3=C(N2)C(OCC3)(CC)CC(=O)OC
InChIKey CRRWJZHQYUTACF-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate (CAS: 122188-02-7) typically synthesized?

Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate is synthesized via a multistep...

Compound Q&A

What industries use Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate (CAS: 122188-02-7)?

Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate (CAS: 122188-02-7)?

When handling Methyl (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate, appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...