Compound Q&A

What industries use trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

Answer

trans-4-Phenyl-L-proline hydrochloride
Trans-4-Phenyl-L-proline hydrochloride is used in the pharmaceutical industry for the synthesis of certain biologically active compounds. It is also utilized in the polymer industry as a monomer for the development of new materials. Additionally, it has applications in sensor technology and semiconductor manufacturing due to its unique chemical properties.

About

CAS No 90657-53-7
English Name trans-4-Phenyl-L-proline hydrochloride
Molecular Formula C11H14ClNO2
Molecular Weight 227.69 g/mol
SMILES C1C(CNC1C(=O)O)C2=CC=CC=C2.Cl
InChIKey LWFBRHSTNWMMGN-UXQCFNEQSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

Trans-4-Phenyl-L-proline hydrochloride is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7) typically synthesized?

Trans-4-Phenyl-L-proline hydrochloride is typically synthesized by reacting L-proline with phenyl is...

Compound Q&A

What precautions should be taken when handling trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

When handling trans-4-Phenyl-L-proline hydrochloride, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...