Compound Q&A

What are the physical and chemical properties of trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

Answer

trans-4-Phenyl-L-proline hydrochloride
Trans-4-Phenyl-L-proline hydrochloride is a white crystalline solid with a molecular weight of approximately 237.24 g/mol. It is slightly soluble in water and ethanol. Chemically, it is stable under normal conditions but can react with strong bases to form the corresponding amine. Its reactivity is moderate, making it useful in various synthetic applications.

About

CAS No 90657-53-7
English Name trans-4-Phenyl-L-proline hydrochloride
Molecular Formula C11H14ClNO2
Molecular Weight 227.69 g/mol
SMILES C1C(CNC1C(=O)O)C2=CC=CC=C2.Cl
InChIKey LWFBRHSTNWMMGN-UXQCFNEQSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7) typically synthesized?

Trans-4-Phenyl-L-proline hydrochloride is typically synthesized by reacting L-proline with phenyl is...

Compound Q&A

What industries use trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

Trans-4-Phenyl-L-proline hydrochloride is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling trans-4-Phenyl-L-proline hydrochloride (CAS: 90657-53-7)?

When handling trans-4-Phenyl-L-proline hydrochloride, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...