Compound Q&A

What industries use 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

Answer

1,3-Diphenyldiselenoxane 1,3-dioxide
1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is used in the pharmaceutical industry for the synthesis of certain organoselenium compounds. It also finds applications in the polymer industry for the preparation of organoselenium-containing polymers, and in the semiconductor industry for the fabrication of high-performance devices.

About

CAS No 17697-12-0
English Name 1,3-Diphenyldiselenoxane 1,3-dioxide
Molecular Formula C12H10O3Se2
Molecular Weight 360.13 g/mol
SMILES C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2
InChIKey FHPZOWOEILXXBD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) typically synthesized?

1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is typically synthesized through the oxidatio...

Compound Q&A

What precautions should be taken when handling 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

When handling 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0), it is essential to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...