Compound Q&A

What are the physical and chemical properties of 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

Answer

1,3-Diphenyldiselenoxane 1,3-dioxide
1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is a crystalline solid with a molecular weight of approximately 342.31 g/mol. It has a high melting point and is only slightly soluble in common organic solvents. It is chemically reactive, particularly under oxidative conditions, making it useful in various chemical transformations.

About

CAS No 17697-12-0
English Name 1,3-Diphenyldiselenoxane 1,3-dioxide
Molecular Formula C12H10O3Se2
Molecular Weight 360.13 g/mol
SMILES C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2
InChIKey FHPZOWOEILXXBD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) typically synthesized?

1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is typically synthesized through the oxidatio...

Compound Q&A

What industries use 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0)?

When handling 1,3-Diphenyldiselenoxane 1,3-dioxide (CAS: 17697-12-0), it is essential to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...