Compound Q&A

What industries use 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

Answer

3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is used in the pharmaceutical industry for the synthesis of certain drug molecules. It also has potential applications in the polymer industry for the development of new materials. Additionally, it may be used in the sensor industry for developing chemical sensors due to its specific reactivity.

About

English Name 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC1(CN(C1)C(=O)OC(C)(C)C)C(=O)O
InChIKey FNWBDXQPGAIDQH-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is a white to off-white c...

Compound Q&A

How is 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0) typically synthesized?

This compound is typically synthesized through the reaction of 2-methyl-2-propanol with 3-azetidinec...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

When handling 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...