Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

Answer

3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 269.34 g/mol. It is moderately soluble in water and ethanol. The compound is relatively stable but can react with bases and amines. It has a pKa of approximately 5.2, indicating it is a weak acid.

About

English Name 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC1(CN(C1)C(=O)OC(C)(C)C)C(=O)O
InChIKey FNWBDXQPGAIDQH-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0) typically synthesized?

This compound is typically synthesized through the reaction of 2-methyl-2-propanol with 3-azetidinec...

Compound Q&A

What industries use 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 887591-62-0)?

When handling 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...