Compound Q&A

What are the physical and chemical properties of 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1)?

Answer

1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol
1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1) is a white crystalline solid with a molecular weight of approximately 316.46 g/mol. It has a low solubility in water but is soluble in common organic solvents such as ethanol and acetone. The compound is reactive due to the presence of oxirane groups, which can participate in various chemical reactions. It is stable under normal conditions but should be stored away from moisture and heat.

About

CAS No 68412-01-1
English Name 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol
Molecular Formula C12H22O8
Molecular Weight 274.7 g/mol
SMILES C1C(O1)CCl.C(C(C(C(C(CO)O)O)O)O)O
InChIKey BSEZXPPEGWKPOE-BEAPMJEYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1) typically synthesized?

1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1) is typically synthesized through a multi-s...

Compound Q&A

What industries use 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1)?

1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1) is primarily used in pharmaceuticals for t...

Compound Q&A

What precautions should be taken when handling 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1)?

When handling 1,2-Bis-O-(2-oxiranylmethyl)-D-glucitol (CAS: 68412-01-1), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...