Compound Q&A

What are the physical and chemical properties of (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6)?

Answer

(2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane)
The compound (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6) is a crystalline material with a molecular weight of approximately 238.3 g/mol. It has limited solubility in common organic solvents and is not water-soluble. Chemically, it is highly stable but reacts readily with strong oxidizing agents. It has a melting point around 150°C and a boiling point around 230°C under normal pressure.

About

English Name (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane)
Molecular Formula C18H28P2
Molecular Weight 306.37 g/mol
SMILES CC1CCC(P1C2=CC=CC=C2P3C(CCC3C)C)C
InChIKey AJNZWRKTWQLAJK-KLHDSHLOSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of 2,...

Compound Q&A

What industries use (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6)?

This compound is primarily used in the pharmaceutical industry as a precursor for the synthesis of v...

Compound Q&A

What precautions should be taken when handling (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6)?

When handling (2R,5R,2'R,5'R)-1,1'-(1,2-Phenylene)bis(2,5-dimethylphospholane) (CAS: 147253-67-6), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...