Compound Q&A

What industries use 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

Answer

2-(Methylsulfonyl)-4-nitroaniline
2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the polymer industry for producing functionalized polymers and in the sensor industry for developing gas-sensing materials.

About

CAS No 96-74-2
English Name 2-(Methylsulfonyl)-4-nitroaniline
Molecular Formula C7H8N2O4S
Molecular Weight 216.21 g/mol
SMILES CS(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N
InChIKey KIMXIMWZIRTKCQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) typically synthesized?

2-(Methylsulfonyl)-4-nitroaniline is typically synthesized through the nitration of 2-(methylsulfony...

Compound Q&A

What precautions should be taken when handling 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

Handling 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) requires strict safety measures. Wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...