Compound Q&A

What are the physical and chemical properties of 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

Answer

2-(Methylsulfonyl)-4-nitroaniline
2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) is a crystalline solid with a molecular weight of approximately 210.15 g/mol. It has a solubility of 6.87 mg/mL in water and is slightly soluble in ethanol. This compound is chemically reactive, particularly towards nucleophilic substitution and reduction reactions.

About

CAS No 96-74-2
English Name 2-(Methylsulfonyl)-4-nitroaniline
Molecular Formula C7H8N2O4S
Molecular Weight 216.21 g/mol
SMILES CS(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N
InChIKey KIMXIMWZIRTKCQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) typically synthesized?

2-(Methylsulfonyl)-4-nitroaniline is typically synthesized through the nitration of 2-(methylsulfony...

Compound Q&A

What industries use 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) is used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2)?

Handling 2-(Methylsulfonyl)-4-nitroaniline (CAS: 96-74-2) requires strict safety measures. Wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...