Compound Q&A

How is Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)] typically synthesized?

Answer

Silane,1,1'-methylenebis[1,1,1-trichloro-
Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) can be synthesized through the reaction of chloromethylsilane and trichlorosilane in the presence of a Lewis acid catalyst. The reaction mixture is typically heated to promote the formation of the desired bis-silane product with good selectivity and yield.

About

CAS No 4142-85-2
English Name Silane,1,1'-methylenebis[1,1,1-trichloro-
Molecular Formula CH2Cl6Si2
Molecular Weight 282.92 g/mol
SMILES C([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl
InChIKey ABDDAHLAEXNYRC-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) is a crystalline solid with a molecular ...

Compound Q&A

What industries use Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) is predominantly used in the semiconduct...

Compound Q&A

What precautions should be taken when handling Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

When handling Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...