Compound Q&A

What are the physical and chemical properties of Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

Answer

Silane,1,1'-methylenebis[1,1,1-trichloro-
Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) is a crystalline solid with a molecular weight of approximately 340.46 g/mol. It has limited solubility in water but is more soluble in organic solvents. The compound is highly reactive, particularly with hydroxyl groups, leading to substitution reactions. It is sensitive to light and should be stored in a dark place.

About

CAS No 4142-85-2
English Name Silane,1,1'-methylenebis[1,1,1-trichloro-
Molecular Formula CH2Cl6Si2
Molecular Weight 282.92 g/mol
SMILES C([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl
InChIKey ABDDAHLAEXNYRC-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)] typically synthesized?

Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) can be synthesized through the reaction ...

Compound Q&A

What industries use Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2) is predominantly used in the semiconduct...

Compound Q&A

What precautions should be taken when handling Silane,1,1'-methylenebis[1,1,1-trichloro-(CAS: 4142-85-2)]?

When handling Silane,1,1'-methylenebis[1,1,1-trichloro-] (CAS: 4142-85-2), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...