Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

Answer

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate
2-Methyl-2-propanyl (3S)-3-hydroxybutanoate finds applications in the pharmaceutical industry as an intermediate in the synthesis of chiral drugs. It is also used in the polymer industry for the development of biodegradable polymers. Additionally, it is utilized in the sensor industry for the production of chiral sensors and in the semiconductor industry for the fabrication of chiral materials.

About

CAS No 82578-45-8
English Name 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate
Molecular Formula C8H16O3
Molecular Weight 160.21 g/mol
SMILES C(C)(C)(C)OC(C[C@H](C)O)=O
InChIKey PKPVFILAHLKSNJ-LURJTMIESA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate is a colorless crystalline solid with a molecular weight...

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8) typically synthesized?

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate is typically synthesized via a multi-step process involv...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

When handling 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate, use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...