Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

Answer

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate
2-Methyl-2-propanyl (3S)-3-hydroxybutanoate is a colorless crystalline solid with a molecular weight of approximately 142.21 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is only slightly soluble in water. This compound exhibits reactivity typical of its ester and hydroxyl functionalities, making it susceptible to hydrolysis under basic conditions. It is also known for its ability to form ester linkages under appropriate conditions.

About

CAS No 82578-45-8
English Name 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate
Molecular Formula C8H16O3
Molecular Weight 160.21 g/mol
SMILES C(C)(C)(C)OC(C[C@H](C)O)=O
InChIKey PKPVFILAHLKSNJ-LURJTMIESA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8) typically synthesized?

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate is typically synthesized via a multi-step process involv...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

2-Methyl-2-propanyl (3S)-3-hydroxybutanoate finds applications in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate (CAS: 82578-45-8)?

When handling 2-Methyl-2-propanyl (3S)-3-hydroxybutanoate, use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...