Compound Q&A

What industries use Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9)?

Answer

Ethyl 6-quinolinecarboxylate
Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9) is used in the pharmaceutical industry as a precursor for the synthesis of certain quinoline-based drugs. It is also utilized in the polymer industry for the production of functionalized polymers with improved properties. Additionally, it can be employed in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 73987-38-9
English Name Ethyl 6-quinolinecarboxylate
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES CCOC(=O)C1=CC2=C(C=C1)N=CC=C2
InChIKey SVHHAAQTOHCWJX-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9)?

Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9) is a yellow crystalline solid with a molecular weight...

Compound Q&A

How is Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9) typically synthesized?

Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9) is typically synthesized via the reaction of 6-quinol...

Compound Q&A

What precautions should be taken when handling Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9)?

When handling Ethyl 6-quinolinecarboxylate (CAS: 73987-38-9), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...