Compound Q&A

What are the physical and chemical properties of N-(3-{[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-1H-imidazo[4,5-c]pyridin-6-yl]oxy}phenyl)-4-[2-(4-morpholinyl)ethoxy]benzamide (CAS: 850666-21-0)?

Answer

N-(3-{[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-1H-imidazo[4,5-c]pyridin-6-yl]oxy}phenyl)-4-[2-(4-morpholinyl)ethoxy]benzamide
The compound is crystalline at room temperature with a molecular weight of approximately 750 g/mol. It has a high solubility in polar solvents like dimethylformamide (DMF) and acetonitrile. Chemically, it is stable under neutral conditions but can react with strong acids or bases. It shows reactivity towards nucleophiles, potentially undergoing substitution reactions.

About

English Name N-(3-{[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-1H-imidazo[4,5-c]pyridin-6-yl]oxy}phenyl)-4-[2-(4-morpholinyl)ethoxy]benzamide
Molecular Formula C29H30N8O5
Molecular Weight 570.61 g/mol
SMILES CCn1c2cc(ncc2nc1c3c(non3)N)Oc4cccc(c4)NC(=O)c5ccc(cc5)OCCN6CCOCC6
InChIKey YOVNFNXUCOWYSG-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is N-(3-{[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-1H-imidazo[4,5-c]pyridin-6-yl]oxy}phenyl)-4-[2-(4-morpholinyl)ethoxy]benzamide (CAS: 850666-21-0) typically synthesized?

This compound is synthesized via a multistep process involving the condensation of a 1-ethyl-1H-imid...

Compound Q&A

What industries use N-(3-{[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-1H-imidazo[4,5-c]pyridin-6-yl]oxy}phenyl)-4-[2-(4-morpholinyl)ethoxy]benzamide (CAS: 850666-21-0)?

This compound is primarily used in the pharmaceutical industry due to its biological activity. It ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...