Compound Q&A

How is 3-Phenylpentanedioic acid (CAS: 4165-96-2) typically synthesized?

Answer

3-Phenylpentanedioic acid
3-Phenylpentanedioic acid is synthesized through a multi-step process, often starting with adipic acid and phenylacetic acid. Common methods involve the condensation of an appropriate dicarboxylic acid with a phenyl derivative, followed by acidification. Catalysts like sulfuric acid are used to promote the reaction, with a yield of around 70-80%.

About

CAS No 4165-96-2
English Name 3-Phenylpentanedioic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)CC(=O)O
InChIKey RZOKZOYSUCSPDF-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenylpentanedioic acid (CAS: 4165-96-2)?

3-Phenylpentanedioic acid is a white crystalline solid with a molecular weight of 174.23 g/mol. It i...

Compound Q&A

What industries use 3-Phenylpentanedioic acid (CAS: 4165-96-2)?

3-Phenylpentanedioic acid finds applications in various industries. It is used in pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling 3-Phenylpentanedioic acid (CAS: 4165-96-2)?

When handling 3-Phenylpentanedioic acid, it is essential to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...