Compound Q&A

What are the physical and chemical properties of (S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol (CAS: 53230-10-7)?

Answer

(S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol
This compound is a crystalline solid with a high molecular weight and low solubility in water. It has a high reactivity towards nucleophiles and electrophiles. The physical properties include a melting point of 270-272°C, and the chemical properties include its ability to undergo nucleophilic substitution and electrophilic aromatic substitution reactions.

About

CAS No 53230-10-7
English Name (S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol
Molecular Formula C17H16F6N2O
Molecular Weight 378.32 g/mol
SMILES C1CCNC(C1)C(C2=CC(=NC3=C2C=CC=C3C(F)(F)F)C(F)(F)F)O
InChIKey XEEQGYMUWCZPDN-DOMZBBRYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is (S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol (CAS: 53230-10-7) typically synthesized?

This compound is synthesized via a multistep synthesis involving the reaction of 2,8-bis(trifluorome...

Compound Q&A

What industries use (S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol (CAS: 53230-10-7)?

This compound is primarily used in the pharmaceutical industry for its biological activity. It also ...

Compound Q&A

What precautions should be taken when handling (S)-[2,8-Bis(trifluoromethyl)-4-quinolinyl][(2R)-2-piperidinyl]methanol (CAS: 53230-10-7)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...