Compound Q&A

What industries use [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

Answer

[1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1)
This compound is primarily used in the pharmaceutical industry for the synthesis of chiral compounds, in the development of new catalysts for polymer synthesis, and in the production of sensitive electronic materials. It also plays a role in sensor technology for detecting volatile organic compounds.

About

English Name [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1)
Molecular Formula C36H50ClN2Pd
Molecular Weight 652.68 g/mol
SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N2CC[N+](=[C-]2)C3=C(C=CC=C3C(C)C)C(C)C.C=C[CH]C1=CC=CC=C1.Cl[Pd+]
InChIKey ITRBAIYFJQRUAV-UHFFFAOYSA-M
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

The compound [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene...

Compound Q&A

How is [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7) typically synthesized?

The compound is synthesized by palladium-catalyzed cross-coupling reactions involving [1,3-Bis(2,6-d...

Compound Q&A

What precautions should be taken when handling [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

Handling this compound requires appropriate personal protective equipment (PPE) including gloves, la...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...