Compound Q&A

What are the physical and chemical properties of [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

Answer

[1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1)
The compound [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7) is a crystalline solid with a high molecular weight, around 600 g/mol. It has low solubility in water but is soluble in organic solvents like dichloromethane and toluene. Chemically, it is highly reactive, particularly towards nucleophiles and exhibits high selectivity in catalytic reactions. Yield and selectivity depend on reaction conditions.

About

English Name [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1)
Molecular Formula C36H50ClN2Pd
Molecular Weight 652.68 g/mol
SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N2CC[N+](=[C-]2)C3=C(C=CC=C3C(C)C)C(C)C.C=C[CH]C1=CC=CC=C1.Cl[Pd+]
InChIKey ITRBAIYFJQRUAV-UHFFFAOYSA-M
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7) typically synthesized?

The compound is synthesized by palladium-catalyzed cross-coupling reactions involving [1,3-Bis(2,6-d...

Compound Q&A

What industries use [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of chiral compounds...

Compound Q&A

What precautions should be taken when handling [1,3-Bis(2,6-diisopropylphenyl)-2-imidazolidinylidene](chloro)palladium - propylbenzene (1:1) (CAS: 884879-24-7)?

Handling this compound requires appropriate personal protective equipment (PPE) including gloves, la...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...