Compound Q&A

What industries use 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

Answer

2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
This compound is primarily used in pharmaceutical research for its potential as a drug lead. It may also have applications in the development of new materials, such as in the synthesis of polymers and sensors. Its use in semiconductors and electronic devices is still under investigation and could be promising.

About

English Name 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
Molecular Formula C12H16ClN3O2
Molecular Weight 269.73 g/mol
SMILES CC(C)(C)OC(=O)N1CCc2ncnc(Cl)c2C1
InChIKey YSSUXXNMVJXCBS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

The compound has a crystalline form with a molecular weight of approximately 280.04 g/mol. It is sli...

Compound Q&A

How is 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2) typically synthesized?

This compound can be synthesized via a multi-step process that starts with the protection of the pri...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

Handling this compound requires appropriate personal protective equipment (PPE) such as gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...