Compound Q&A

How is 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2) typically synthesized?

Answer

2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
This compound can be synthesized via a multi-step process that starts with the protection of the primary amine, followed by a ring closure to form the pyridopyrimidine core, and then deprotection to yield the final carboxylate. Commonly used catalysts include benzotriazol-1-yloxy-tripyrrolidine-phosphonium hexafluorophosphate (BOP) and 1-hydroxybenzotriazole (HOBt). The reaction typically yields a mixture that requires purification.

About

English Name 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
Molecular Formula C12H16ClN3O2
Molecular Weight 269.73 g/mol
SMILES CC(C)(C)OC(=O)N1CCc2ncnc(Cl)c2C1
InChIKey YSSUXXNMVJXCBS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

The compound has a crystalline form with a molecular weight of approximately 280.04 g/mol. It is sli...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

This compound is primarily used in pharmaceutical research for its potential as a drug lead. It may ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate (CAS: 1056934-87-2)?

Handling this compound requires appropriate personal protective equipment (PPE) such as gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...