Compound Q&A

How is N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8) typically synthesized?

Answer

N-Succinimidyl 4-(p-Maleimidophenyl)butyrate
N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8) is typically synthesized by the condensation of succinimidyl butyrate with 4-maleimidophenyl boronic acid in the presence of a base like triethylamine. The reaction yields the desired product with good selectivity and yield. The process involves careful monitoring of pH and temperature to optimize the reaction conditions.

About

CAS No 79886-55-8
English Name N-Succinimidyl 4-(p-Maleimidophenyl)butyrate
Molecular Formula C18H16N2O6
Molecular Weight 356.33 g/mol
SMILES C1CC(=O)N(C1=O)OC(=O)CCCC2=CC=C(C=C2)N3C(=O)C=CC3=O
InChIKey PMJWDPGOWBRILU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8)?

N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8) is a white to off-white crystalline s...

Compound Q&A

What industries use N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8)?

N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8) is widely used in various industries ...

Compound Q&A

What precautions should be taken when handling N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8)?

When handling N-Succinimidyl 4-(p-Maleimidophenyl)butyrate (CAS: 79886-55-8), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...