Compound Q&A

How is Gatifloxacin mesylate (CAS: 316819-28-0) typically synthesized?

Answer

Gatifloxacin mesylate
Gatifloxacin mesylate (CAS: 316819-28-0) is synthesized by reacting gatifloxacin with methanesulfonyl chloride in the presence of a base like triethylamine. The reaction is typically carried out in a solvent such as dichloromethane. The yield is generally high, and the product undergoes purification by recrystallization.

About

English Name Gatifloxacin mesylate
Molecular Formula C20H26FN3O7S
Molecular Weight 471.51 g/mol
SMILES CC1CN(CCN1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F.CS(=O)(=O)O
InChIKey PMMNVFFMFJMFDB-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Gatifloxacin mesylate (CAS: 316819-28-0)?

Gatifloxacin mesylate (CAS: 316819-28-0) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Gatifloxacin mesylate (CAS: 316819-28-0)?

Gatifloxacin mesylate (CAS: 316819-28-0) is primarily used in the pharmaceutical industry. It is an ...

Compound Q&A

What precautions should be taken when handling Gatifloxacin mesylate (CAS: 316819-28-0)?

When handling Gatifloxacin mesylate (CAS: 316819-28-0), it is essential to use proper personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...