Compound Q&A

What industries use 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

Answer

5-Fluoro-2-(trifluoromethyl)benzoic acid
5-Fluoro-2-(trifluoromethyl)benzoic acid is used in the pharmaceutical industry for the synthesis of drugs, particularly those that require specific substituents for bioactivity. It also finds applications in the polymer industry for the development of advanced materials and in chemical sensors for detecting specific analytes.

About

CAS No 654-99-9
English Name 5-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES C1=CC(=C(C=C1F)C(=O)O)C(F)(F)F
InChIKey BRFNBGWEOKQIND-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

5-Fluoro-2-(trifluoromethyl)benzoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9) typically synthesized?

5-Fluoro-2-(trifluoromethyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

When handling 5-Fluoro-2-(trifluoromethyl)benzoic acid, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...