Compound Q&A

How is 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9) typically synthesized?

Answer

5-Fluoro-2-(trifluoromethyl)benzoic acid
5-Fluoro-2-(trifluoromethyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation of benzoic acid with trifluoromethyl triflate in the presence of aluminum chloride as a catalyst. The reaction yields the compound with high selectivity, and purification can be achieved through recrystallization.

About

CAS No 654-99-9
English Name 5-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES C1=CC(=C(C=C1F)C(=O)O)C(F)(F)F
InChIKey BRFNBGWEOKQIND-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

5-Fluoro-2-(trifluoromethyl)benzoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

5-Fluoro-2-(trifluoromethyl)benzoic acid is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 654-99-9)?

When handling 5-Fluoro-2-(trifluoromethyl)benzoic acid, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...