Compound Q&A

What industries use 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

Answer

2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione
This compound is used in the pharmaceutical industry for the synthesis of certain bioactive molecules. It is also relevant in the polymer industry for developing novel materials with specific properties. Additionally, it finds applications in the sensor and semiconductor industries for its unique chemical and physical properties.

About

English Name 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione
Molecular Formula C13H9FN2O4
Molecular Weight 276.22 g/mol
SMILES Fc1ccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c2c1
InChIKey MPQLCQKBYRSPNA-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

The compound has a crystalline form and a molecular weight of approximately 305.21 g/mol. It is poor...

Compound Q&A

How is 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0) typically synthesized?

The compound is synthesized via a multi-step process involving condensation reactions and ring-closi...

Compound Q&A

What precautions should be taken when handling 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

Proper personal protective equipment (PPE) is essential, including gloves, goggles, and a lab coat. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...