Compound Q&A

How is 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0) typically synthesized?

Answer

2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione
The compound is synthesized via a multi-step process involving condensation reactions and ring-closing reactions. Catalysts like p-toluenesulfonic acid are used to improve yield and selectivity. The process often involves careful control of pH and temperature to ensure the desired product is formed.

About

English Name 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione
Molecular Formula C13H9FN2O4
Molecular Weight 276.22 g/mol
SMILES Fc1ccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c2c1
InChIKey MPQLCQKBYRSPNA-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

The compound has a crystalline form and a molecular weight of approximately 305.21 g/mol. It is poor...

Compound Q&A

What industries use 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

This compound is used in the pharmaceutical industry for the synthesis of certain bioactive molecule...

Compound Q&A

What precautions should be taken when handling 2-(2,6-Dioxo-3-piperidinyl)-5-fluoro-1H-isoindole-1,3(2H)-dione (CAS: 835616-61-0)?

Proper personal protective equipment (PPE) is essential, including gloves, goggles, and a lab coat. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...