Compound Q&A

What are the physical and chemical properties of 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) (CAS: 18498-01-6)?

Answer

1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1)
1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) is a crystalline compound with a molecular weight of approximately 632.5 g/mol. It has low solubility in water but is soluble in organic solvents like chloroform. This compound exhibits coordination chemistry typical of cobalt(II) complexes, showing reactivity in organic synthesis and catalysis contexts.

About

CAS No 18498-01-6
English Name 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1)
Molecular Formula C26H24Cl2CoP2
Molecular Weight 528.27 g/mol
SMILES C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Co]Cl
InChIKey SYTWXWRJCLAZFP-UHFFFAOYSA-L
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) (CAS: 18498-01-6) typically synthesized?

1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) is synthesized by reacting dichlorocobal...

Compound Q&A

What industries use 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) (CAS: 18498-01-6)?

1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) is utilized in various industries, inclu...

Compound Q&A

What precautions should be taken when handling 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1) (CAS: 18498-01-6)?

When handling 1,2-Ethanediylbis(diphenylphosphine) - dichlorocobalt (1:1), it is crucial to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...