Compound Q&A

What precautions should be taken when handling 1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5)?

Answer

1,2,4-triazolo[4,3-a]pyridin-3-ol
Proper handling of 1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5) is essential to ensure safety. Wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat, when handling the compound. Work in a well-ventilated area or a fume hood to minimize exposure. Store the compound in a cool, dry place away from incompatible materials. In case of a spill, notify your supervisor and follow the appropriate spill cleanup procedures as outlined in the safety data sheet (SDS).

About

CAS No 71-62-5
English Name 1,2,4-triazolo[4,3-a]pyridin-3-ol
Molecular Formula C6H5N3O
Molecular Weight 135.13 g/mol
SMILES CC1CCC2C(C3(C(CC4(C5CCC6C7(C5(CC4(C3CN2C1)O)OC6(C(CC7)OC(=O)C8=CC(=C(C=C8)OC)OC)O)C)O)O)O)(C)O
InChIKey LJRXNXBFJXXRNQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5)?

1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5) typically synthesized?

1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5) is commonly synthesized via the condensation of 3-a...

Compound Q&A

What industries use 1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5)?

1,2,4-triazolo[4,3-a]pyridin-3-ol (CAS: 71-62-5) finds applications in various industries. It is use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...