Compound Q&A

How is Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) typically synthesized?

Answer

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate
Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is typically synthesized via a multi-step process involving the formation of a pyrimidine ring followed by amino and thio substitution. Key steps include the condensation of an amino acid derivative with a pyrimidine, followed by a thio substitution reaction. Catalysts like titanium tetrachloride are often used to improve the yield and selectivity of the reaction.

About

CAS No 774-07-2
English Name Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate
Molecular Formula C7H9N3O2S
Molecular Weight 199.24 g/mol
SMILES CCOC(=O)C1=C(NC(=S)N=C1)N
InChIKey DKTWKRWWQKVQQB-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is a crystalline solid wi...

Compound Q&A

What industries use Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is used in a variety of i...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

When handling Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...