Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

Answer

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate
Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is a crystalline solid with a molecular weight of approximately 218.21 g/mol. It is sparingly soluble in water and more soluble in organic solvents like methanol and ethanol. The compound is known for its reactivity, particularly towards nucleophilic substitution reactions. It also exhibits some basic properties due to the amino group.

About

CAS No 774-07-2
English Name Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate
Molecular Formula C7H9N3O2S
Molecular Weight 199.24 g/mol
SMILES CCOC(=O)C1=C(NC(=S)N=C1)N
InChIKey DKTWKRWWQKVQQB-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) typically synthesized?

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is typically synthesized ...

Compound Q&A

What industries use Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2) is used in a variety of i...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2)?

When handling Ethyl 4-amino-2-thioxo-1,2-dihydro-5-pyrimidinecarboxylate (CAS: 774-07-2), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...