Compound Q&A

What industries use 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

Answer

1,3,5-Tribromo-2,4,6-trimethylbenzene
1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the polymer industry as a flame retardant additive. Additionally, it is used in the production of sensors and as a precursor in the semiconductor industry.

About

CAS No 608-72-0
English Name 1,3,5-Tribromo-2,4,6-trimethylbenzene
Molecular Formula C9H9Br3
Molecular Weight 356.88 g/mol
SMILES Cc1c(Br)c(C)c(c(c1Br)C)Br
InChIKey LTSSSVHTLGQZAQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) is a solid at room temperature with a crystall...

Compound Q&A

How is 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) typically synthesized?

1,3,5-Tribromo-2,4,6-trimethylbenzene is typically synthesized through the bromination of 1,3,5-trim...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

When handling 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...