Compound Q&A

What are the physical and chemical properties of 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

Answer

1,3,5-Tribromo-2,4,6-trimethylbenzene
1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) is a solid at room temperature with a crystalline form. Its molecular weight is approximately 336.06 g/mol. It has low solubility in water but is more soluble in organic solvents like benzene and toluene. Chemically, it is highly reactive due to the presence of bromine and methyl groups, making it susceptible to substitution reactions.

About

CAS No 608-72-0
English Name 1,3,5-Tribromo-2,4,6-trimethylbenzene
Molecular Formula C9H9Br3
Molecular Weight 356.88 g/mol
SMILES Cc1c(Br)c(C)c(c(c1Br)C)Br
InChIKey LTSSSVHTLGQZAQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) typically synthesized?

1,3,5-Tribromo-2,4,6-trimethylbenzene is typically synthesized through the bromination of 1,3,5-trim...

Compound Q&A

What industries use 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0) is used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0)?

When handling 1,3,5-Tribromo-2,4,6-trimethylbenzene (CAS: 608-72-0), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...