Compound Q&A

What industries use [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

Answer

[2-(Benzyloxy)-4-fluorophenyl]boronic acid
[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is primarily used in the pharmaceutical industry for the synthesis of drug precursors and intermediates, as well as in the polymer industry for the development of advanced materials. It also finds applications in the field of sensors for its unique chemical reactivity and in semiconductor manufacturing due to its stability and reactivity.

About

English Name [2-(Benzyloxy)-4-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.04600000000005 g/mol
SMILES Fc1ccc(c(c1)OCc1ccccc1)B(O)O
InChIKey IFPQNCKVOQKEIU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is a white crystalline solid with a mo...

Compound Q&A

How is [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) typically synthesized?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is commonly synthesized through a mult...

Compound Q&A

What precautions should be taken when handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

When handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3), it is essential to use ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...