Compound Q&A

What are the physical and chemical properties of [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

Answer

[2-(Benzyloxy)-4-fluorophenyl]boronic acid
[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is a white crystalline solid with a molecular weight of approximately 295.22 g/mol. It has low solubility in water (0.01 g/100 mL at 25°C) but is more soluble in organic solvents such as dichloromethane and methanol. Chemically, it is a boronic acid derivative and is known for its reactivity in nucleophilic aromatic substitution reactions and its ability to form stable complexes with transition metals.

About

English Name [2-(Benzyloxy)-4-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.04600000000005 g/mol
SMILES Fc1ccc(c(c1)OCc1ccccc1)B(O)O
InChIKey IFPQNCKVOQKEIU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) typically synthesized?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is commonly synthesized through a mult...

Compound Q&A

What industries use [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

When handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3), it is essential to use ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...