Compound Q&A

How is [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) typically synthesized?

Answer

[2-(Benzyloxy)-4-fluorophenyl]boronic acid
[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is commonly synthesized through a multistep process involving the formation of a benzylic ether followed by the introduction of a fluoro group and the subsequent conversion to boronic acid. This typically involves the use of reagents such as benzyl alcohol, fluoroacetic acid, and boron reagents like sodium or potassium borohydride. The reaction conditions usually require temperature control and the use of appropriate solvents to ensure high yield and selectivity.

About

English Name [2-(Benzyloxy)-4-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.04600000000005 g/mol
SMILES Fc1ccc(c(c1)OCc1ccccc1)B(O)O
InChIKey IFPQNCKVOQKEIU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is a white crystalline solid with a mo...

Compound Q&A

What industries use [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

[2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3)?

When handling [2-(Benzyloxy)-4-fluorophenyl]boronic acid (CAS: 848779-87-3), it is essential to use ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...