Compound Q&A

What precautions should be taken when handling 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

Answer

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid
When handling 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be immediately cleaned up with appropriate absorbent material and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid
Molecular Formula C13H7F3INO2
Molecular Weight 393.1 g/mol
SMILES C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)O
InChIKey REMYZOSCCVDLDL-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is a white crystalline ...

Compound Q&A

How is 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) typically synthesized?

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is typically synthesize...

Compound Q&A

What industries use 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is primarily used in th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...